C12H13Cl2NO3 — CID 114113234
3-[(4,6-dichloro-3-pyridinyl)methyl]oxane-3-carboxylic acid (PubChem CID 114113234) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 3-[(4,6-dichloro-3-pyridinyl)methyl]oxane-3-carboxylic acid.
| Compound Name | 3-[(4,6-dichloro-3-pyridinyl)methyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 114113234 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 3-[(4,6-dichloro-3-pyridinyl)methyl]oxane-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2cnc(Cl)cc2Cl)CCCOC1 |
| InChI | InChI=1S/C12H13Cl2NO3/c13-9-4-10(14)15-6-8(9)5-12(11(16)17)2-1-3-18-7-12/h4,6H,1-3,5,7H2,(H,16,17) |
| InChIKey | MVKYRHUOOQADGY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|