C12H12ClFO3 — CID 114851096
3-[(4-chloro-2-fluorophenyl)methyl]oxolane-3-carboxylic acid (PubChem CID 114851096) has the molecular formula C12H12ClFO3 and a molecular weight of 258.68 g/mol. Its IUPAC name is 3-[(4-chloro-2-fluorophenyl)methyl]oxolane-3-carboxylic acid.
| Compound Name | 3-[(4-chloro-2-fluorophenyl)methyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114851096 |
| Molecular Formula | C12H12ClFO3 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 3-[(4-chloro-2-fluorophenyl)methyl]oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(Cl)cc2F)CCOC1 |
| InChI | InChI=1S/C12H12ClFO3/c13-9-2-1-8(10(14)5-9)6-12(11(15)16)3-4-17-7-12/h1-2,5H,3-4,6-7H2,(H,15,16) |
| InChIKey | NOCVKDDSYAPLOQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |