C14H17ClFNO4 — CID 167983419
3-[[(5-chloro-4-fluoro-2-hydroxyphenyl)methylamino]methyl]oxane-3-carboxylic acid (PubChem CID 167983419) has the molecular formula C14H17ClFNO4 and a molecular weight of 317.74 g/mol. Its IUPAC name is 3-[[(5-chloro-4-fluoro-2-hydroxyphenyl)methylamino]methyl]oxane-3-carboxylic acid.
| Compound Name | 3-[[(5-chloro-4-fluoro-2-hydroxyphenyl)methylamino]methyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 167983419 |
| Molecular Formula | C14H17ClFNO4 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-[[(5-chloro-4-fluoro-2-hydroxyphenyl)methylamino]methyl]oxane-3-carboxylic acid |
| SMILES | O=C(O)C1(CNCc2cc(Cl)c(F)cc2O)CCCOC1 |
| InChI | InChI=1S/C14H17ClFNO4/c15-10-4-9(12(18)5-11(10)16)6-17-7-14(13(19)20)2-1-3-21-8-14/h4-5,17-18H,1-3,6-8H2,(H,19,20) |
| InChIKey | DZBCGFKPXTZMED-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|