C15H20O3 — CID 63015767
3-[(2,5-dimethylphenyl)methyl]oxane-3-carboxylic acid (PubChem CID 63015767) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)methyl]oxane-3-carboxylic acid.
| Compound Name | 3-[(2,5-dimethylphenyl)methyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 63015767 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)methyl]oxane-3-carboxylic acid |
| SMILES | Cc1ccc(C)c(CC2(C(=O)O)CCCOC2)c1 |
| InChI | InChI=1S/C15H20O3/c1-11-4-5-12(2)13(8-11)9-15(14(16)17)6-3-7-18-10-15/h4-5,8H,3,6-7,9-10H2,1-2H3,(H,16,17) |
| InChIKey | SSAOBESBOHGYSR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |