C15H23N7O — CID 95886653
(3R)-3-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]piperidin-3-ol (PubChem CID 95886653) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is (3R)-3-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]piperidin-3-ol.
| Compound Name | (3R)-3-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 95886653 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3R)-3-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]piperidin-3-ol |
| SMILES | O[C@]1(CN2CCN(c3ncnc4nc[nH]c34)CC2)CCCNC1 |
| InChI | InChI=1S/C15H23N7O/c23-15(2-1-3-16-8-15)9-21-4-6-22(7-5-21)14-12-13(18-10-17-12)19-11-20-14/h10-11,16,23H,1-9H2,(H,17,18,19,20)/t15-/m1/s1 |
| InChIKey | YDRBLFFIBNIZDS-OAHLLOKOSA-N |
| XLogP | -0.41 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |