C16H22N6O2 — CID 138381499
(2-methyloxolan-2-yl)-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 138381499) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2-methyloxolan-2-yl)-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-methyloxolan-2-yl)-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 138381499 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2-methyloxolan-2-yl)-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCCN(c3ncnc4nc[nH]c34)CC2)CCCO1 |
| InChI | InChI=1S/C16H22N6O2/c1-16(4-2-9-24-16)15(23)22-6-3-5-21(7-8-22)14-12-13(18-10-17-12)19-11-20-14/h10-11H,2-9H2,1H3,(H,17,18,19,20) |
| InChIKey | SWZQTEFLTYFTGY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |