C14H17N7S — CID 133476564
2-[1-[4-(7H-purin-6-yl)piperazin-1-yl]ethyl]-1,3-thiazole (PubChem CID 133476564) has the molecular formula C14H17N7S and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-[1-[4-(7H-purin-6-yl)piperazin-1-yl]ethyl]-1,3-thiazole.
| Compound Name | 2-[1-[4-(7H-purin-6-yl)piperazin-1-yl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 133476564 |
| Molecular Formula | C14H17N7S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[1-[4-(7H-purin-6-yl)piperazin-1-yl]ethyl]-1,3-thiazole |
| SMILES | CC(c1nccs1)N1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C14H17N7S/c1-10(14-15-2-7-22-14)20-3-5-21(6-4-20)13-11-12(17-8-16-11)18-9-19-13/h2,7-10H,3-6H2,1H3,(H,16,17,18,19) |
| InChIKey | VUYRYAWHXNDXIZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |