C15H14N8S2 — CID 108772850
2-[4-(7H-purin-6-yl)piperazin-1-yl]-5-thiophen-2-yl-1,3,4-thiadiazole (PubChem CID 108772850) has the molecular formula C15H14N8S2 and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[4-(7H-purin-6-yl)piperazin-1-yl]-5-thiophen-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-[4-(7H-purin-6-yl)piperazin-1-yl]-5-thiophen-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 108772850 |
| Molecular Formula | C15H14N8S2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[4-(7H-purin-6-yl)piperazin-1-yl]-5-thiophen-2-yl-1,3,4-thiadiazole |
| SMILES | c1csc(-c2nnc(N3CCN(c4ncnc5nc[nH]c45)CC3)s2)c1 |
| InChI | InChI=1S/C15H14N8S2/c1-2-10(24-7-1)14-20-21-15(25-14)23-5-3-22(4-6-23)13-11-12(17-8-16-11)18-9-19-13/h1-2,7-9H,3-6H2,(H,16,17,18,19) |
| InChIKey | JSNBOZWQXOHIBB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |