C17H15IN4OS2 — CID 108753521
(2-iodophenyl)-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 108753521) has the molecular formula C17H15IN4OS2 and a molecular weight of 482.37 g/mol. Its IUPAC name is (2-iodophenyl)-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108753521 |
| Molecular Formula | C17H15IN4OS2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | (2-iodophenyl)-[4-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(c2nnc(-c3cccs3)s2)CC1 |
| InChI | InChI=1S/C17H15IN4OS2/c18-13-5-2-1-4-12(13)16(23)21-7-9-22(10-8-21)17-20-19-15(25-17)14-6-3-11-24-14/h1-6,11H,7-10H2 |
| InChIKey | FRIBYLRYHOMHNY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|