C13H19N5S — CID 95622987
6-[(3S)-3-ethylsulfanylazepan-1-yl]-7H-purine (PubChem CID 95622987) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 6-[(3S)-3-ethylsulfanylazepan-1-yl]-7H-purine.
| Compound Name | 6-[(3S)-3-ethylsulfanylazepan-1-yl]-7H-purine |
|---|---|
| PubChem CID | 95622987 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 6-[(3S)-3-ethylsulfanylazepan-1-yl]-7H-purine |
| SMILES | CCS[C@H]1CCCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C13H19N5S/c1-2-19-10-5-3-4-6-18(7-10)13-11-12(15-8-14-11)16-9-17-13/h8-10H,2-7H2,1H3,(H,14,15,16,17)/t10-/m0/s1 |
| InChIKey | ZBNJRKZDHHDACE-JTQLQIEISA-N |
| XLogP | 2.46 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |