C14H18N8 — CID 167781309
6-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-7H-purine (PubChem CID 167781309) has the molecular formula C14H18N8 and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-7H-purine.
| Compound Name | 6-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 167781309 |
| Molecular Formula | C14H18N8 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 6-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)piperidin-1-yl]-7H-purine |
| SMILES | Cc1nc(C)n(C2CCCN(c3ncnc4nc[nH]c34)C2)n1 |
| InChI | InChI=1S/C14H18N8/c1-9-19-10(2)22(20-9)11-4-3-5-21(6-11)14-12-13(16-7-15-12)17-8-18-14/h7-8,11H,3-6H2,1-2H3,(H,15,16,17,18) |
| InChIKey | NQNOTRLOLKWCCN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |