About 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride
4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride (PubChem CID 119906320) has the molecular formula C13H25Cl2N3S
and a molecular weight of 326.34 g/mol. Its IUPAC name is 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride |
| PubChem CID | 119906320 |
| Molecular Formula | C13H25Cl2N3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride |
| SMILES | CC(C)(C)c1csc(CN2CCCNCC2)n1.Cl.Cl |
| InChI | InChI=1S/C13H23N3S.2ClH/c1-13(2,3)11-10-17-12(15-11)9-16-7-4-5-14-6-8-16;;/h10,14H,4-9H2,1-3H3;2*1H |
| InChIKey | KDORAXDWQLDSTM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride?
The IUPAC name of 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride (CID 119906320) is 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride?
The canonical SMILES for 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride is CC(C)(C)c1csc(CN2CCCNCC2)n1.Cl.Cl.
What is the InChIKey of 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride?
The InChIKey is KDORAXDWQLDSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3S.2ClH/c1-13(2,3)11-10-17-12(15-11)9-16-7-4-5-14-6-8-16;;/h10,14H,4-9H2,1-3H3;2*1H.
What are the key properties of 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride?
4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride has a molecular weight of 326.34 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(1,4-diazepan-1-ylmethyl)-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 119906320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).