C13H21BrN2S — CID 80690042
2-[[3-(bromomethyl)pyrrolidin-1-yl]methyl]-4-tert-butyl-1,3-thiazole (PubChem CID 80690042) has the molecular formula C13H21BrN2S and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-[[3-(bromomethyl)pyrrolidin-1-yl]methyl]-4-tert-butyl-1,3-thiazole.
| Compound Name | 2-[[3-(bromomethyl)pyrrolidin-1-yl]methyl]-4-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 80690042 |
| Molecular Formula | C13H21BrN2S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[[3-(bromomethyl)pyrrolidin-1-yl]methyl]-4-tert-butyl-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(CN2CCC(CBr)C2)n1 |
| InChI | InChI=1S/C13H21BrN2S/c1-13(2,3)11-9-17-12(15-11)8-16-5-4-10(6-14)7-16/h9-10H,4-8H2,1-3H3 |
| InChIKey | JCDVNISSBHCBHH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|