C18H22N6 — CID 26021234
4-(4-benzyl-1,4-diazepan-1-yl)-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 26021234) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 4-(4-benzyl-1,4-diazepan-1-yl)-1-methylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-(4-benzyl-1,4-diazepan-1-yl)-1-methylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 26021234 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-(4-benzyl-1,4-diazepan-1-yl)-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(N3CCCN(Cc4ccccc4)CC3)ncnc21 |
| InChI | InChI=1S/C18H22N6/c1-22-17-16(12-21-22)18(20-14-19-17)24-9-5-8-23(10-11-24)13-15-6-3-2-4-7-15/h2-4,6-7,12,14H,5,8-11,13H2,1H3 |
| InChIKey | KUNJIJJNLCYEKI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |