C17H15F5N6 — CID 18150395
1-methyl-4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]piperazin-1-yl]pyrazolo[5,4-d]pyrimidine (PubChem CID 18150395) has the molecular formula C17H15F5N6 and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-methyl-4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]piperazin-1-yl]pyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-methyl-4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]piperazin-1-yl]pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 18150395 |
| Molecular Formula | C17H15F5N6 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-methyl-4-[4-[(2,3,4,5,6-pentafluorophenyl)methyl]piperazin-1-yl]pyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(N3CCN(Cc4c(F)c(F)c(F)c(F)c4F)CC3)ncnc21 |
| InChI | InChI=1S/C17H15F5N6/c1-26-16-9(6-25-26)17(24-8-23-16)28-4-2-27(3-5-28)7-10-11(18)13(20)15(22)14(21)12(10)19/h6,8H,2-5,7H2,1H3 |
| InChIKey | BAWMCUMPTVRHAT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|