C17H15FN8O2 — CID 19151134
N'-[5-amino-6-[2-(4-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19151134) has the molecular formula C17H15FN8O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(4-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-[2-(4-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19151134 |
| Molecular Formula | C17H15FN8O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N'-[5-amino-6-[2-(4-fluorobenzoyl)hydrazinyl]pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(F)cc2)ncnc1NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C17H15FN8O2/c18-12-5-3-10(4-6-12)16(27)25-23-14-13(19)15(22-9-21-14)24-26-17(28)11-2-1-7-20-8-11/h1-9H,19H2,(H,25,27)(H,26,28)(H2,21,22,23,24) |
| InChIKey | OVNIVTMEJGQZAT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|