C15H19FN6O — CID 22540325
N'-[5-amino-6-(tert-butylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 22540325) has the molecular formula C15H19FN6O and a molecular weight of 318.36 g/mol. Its IUPAC name is N'-[5-amino-6-(tert-butylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(tert-butylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22540325 |
| Molecular Formula | C15H19FN6O |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N'-[5-amino-6-(tert-butylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | CC(C)(C)Nc1ncnc(NNC(=O)c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C15H19FN6O/c1-15(2,3)20-12-11(17)13(19-8-18-12)21-22-14(23)9-4-6-10(16)7-5-9/h4-8H,17H2,1-3H3,(H,22,23)(H2,18,19,20,21) |
| InChIKey | QBJRIYANEIUOCN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|