C18H17FN6O — CID 19147812
N'-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 19147812) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is N'-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 19147812 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N'-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | Cc1ccccc1Nc1ncnc(NNC(=O)c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C18H17FN6O/c1-11-4-2-3-5-14(11)23-16-15(20)17(22-10-21-16)24-25-18(26)12-6-8-13(19)9-7-12/h2-10H,20H2,1H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | KHJAOZUZRPRQQP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|