C15H20ClN7O — CID 19150984
N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-4-chlorobenzohydrazide (PubChem CID 19150984) has the molecular formula C15H20ClN7O and a molecular weight of 349.83 g/mol. Its IUPAC name is N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-4-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-4-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19150984 |
| Molecular Formula | C15H20ClN7O |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-4-chlorobenzohydrazide |
| SMILES | CC(C)(C)NNc1ncnc(NNC(=O)c2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C15H20ClN7O/c1-15(2,3)23-21-13-11(17)12(18-8-19-13)20-22-14(24)9-4-6-10(16)7-5-9/h4-8,23H,17H2,1-3H3,(H,22,24)(H2,18,19,20,21) |
| InChIKey | OAESRVGYFOKIOO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|