C19H18ClN7O2 — CID 19150707
N'-[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]-4-methylbenzohydrazide (PubChem CID 19150707) has the molecular formula C19H18ClN7O2 and a molecular weight of 411.85 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]-4-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150707 |
| Molecular Formula | C19H18ClN7O2 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N'-[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2N)cc1 |
| InChI | InChI=1S/C19H18ClN7O2/c1-11-2-4-12(5-3-11)18(28)26-24-16-15(21)17(23-10-22-16)25-27-19(29)13-6-8-14(20)9-7-13/h2-10H,21H2,1H3,(H,26,28)(H,27,29)(H2,22,23,24,25) |
| InChIKey | HQFAUOCYOWVAQM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|