C19H20N6O — CID 19148584
N'-[5-amino-6-(4-methylanilino)pyrimidin-4-yl]-4-methylbenzohydrazide (PubChem CID 19148584) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methylanilino)pyrimidin-4-yl]-4-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-methylanilino)pyrimidin-4-yl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 19148584 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N'-[5-amino-6-(4-methylanilino)pyrimidin-4-yl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(Nc2ncnc(NNC(=O)c3ccc(C)cc3)c2N)cc1 |
| InChI | InChI=1S/C19H20N6O/c1-12-3-7-14(8-4-12)19(26)25-24-18-16(20)17(21-11-22-18)23-15-9-5-13(2)6-10-15/h3-11H,20H2,1-2H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | HQOYRBLWCLKLJI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|