C14H20N8O — CID 19151902
N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19151902) has the molecular formula C14H20N8O and a molecular weight of 316.37 g/mol. Its IUPAC name is N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19151902 |
| Molecular Formula | C14H20N8O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N'-[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | CC(C)(C)NNc1ncnc(NNC(=O)c2cccnc2)c1N |
| InChI | InChI=1S/C14H20N8O/c1-14(2,3)22-20-12-10(15)11(17-8-18-12)19-21-13(23)9-5-4-6-16-7-9/h4-8,22H,15H2,1-3H3,(H,21,23)(H2,17,18,19,20) |
| InChIKey | XZXSVGNSQQDURI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|