C17H16N6OS — CID 19149909
N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19149909) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19149909 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Cc1ccc(Sc2ncnc(NNC(=O)c3cccnc3)c2N)cc1 |
| InChI | InChI=1S/C17H16N6OS/c1-11-4-6-13(7-5-11)25-17-14(18)15(20-10-21-17)22-23-16(24)12-3-2-8-19-9-12/h2-10H,18H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | QQYRTYDYDGWUFW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|