C18H16BrN5OS — CID 19149902
N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]-2-bromobenzohydrazide (PubChem CID 19149902) has the molecular formula C18H16BrN5OS and a molecular weight of 430.33 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]-2-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 19149902 |
| Molecular Formula | C18H16BrN5OS |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | N'-[5-amino-6-(4-methylphenyl)sulfanylpyrimidin-4-yl]-2-bromobenzohydrazide |
| SMILES | Cc1ccc(Sc2ncnc(NNC(=O)c3ccccc3Br)c2N)cc1 |
| InChI | InChI=1S/C18H16BrN5OS/c1-11-6-8-12(9-7-11)26-18-15(20)16(21-10-22-18)23-24-17(25)13-4-2-3-5-14(13)19/h2-10H,20H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | MUMMAAACBZJIRP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|