C21H18N6OS — CID 19150789
N'-(5-amino-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-4-methylbenzohydrazide (PubChem CID 19150789) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is N'-(5-amino-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-4-methylbenzohydrazide.
| Compound Name | N'-(5-amino-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150789 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N'-(5-amino-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2ncnc(Sc3cccc4cccnc34)c2N)cc1 |
| InChI | InChI=1S/C21H18N6OS/c1-13-7-9-15(10-8-13)20(28)27-26-19-17(22)21(25-12-24-19)29-16-6-2-4-14-5-3-11-23-18(14)16/h2-12H,22H2,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | JDMAUPOYEWLKQO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|