C20H14N6O3S — CID 22535072
N'-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)benzohydrazide (PubChem CID 22535072) has the molecular formula C20H14N6O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is N'-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)benzohydrazide.
| Compound Name | N'-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 22535072 |
| Molecular Formula | C20H14N6O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N'-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc(Sc2cccc3cccnc23)c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H14N6O3S/c27-19(14-6-2-1-3-7-14)25-24-18-17(26(28)29)20(23-12-22-18)30-15-10-4-8-13-9-5-11-21-16(13)15/h1-12H,(H,25,27)(H,22,23,24) |
| InChIKey | ULRRMBDEYDBASL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|