C17H18N6O2S — CID 22537586
1-tert-butyl-2-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)hydrazine (PubChem CID 22537586) has the molecular formula C17H18N6O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-tert-butyl-2-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)hydrazine.
| Compound Name | 1-tert-butyl-2-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 22537586 |
| Molecular Formula | C17H18N6O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-tert-butyl-2-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)hydrazine |
| SMILES | CC(C)(C)NNc1ncnc(Sc2cccc3cccnc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N6O2S/c1-17(2,3)22-21-15-14(23(24)25)16(20-10-19-15)26-12-8-4-6-11-7-5-9-18-13(11)12/h4-10,22H,1-3H3,(H,19,20,21) |
| InChIKey | UVGPPKDRLZKZTP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|