C23H22N6O4S2 — CID 22527927
N,N-diethyl-4-[(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)amino]benzenesulfonamide (PubChem CID 22527927) has the molecular formula C23H22N6O4S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is N,N-diethyl-4-[(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 22527927 |
| Molecular Formula | C23H22N6O4S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | N,N-diethyl-4-[(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(Sc3cccc4cccnc34)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22N6O4S2/c1-3-28(4-2)35(32,33)18-12-10-17(11-13-18)27-22-21(29(30)31)23(26-15-25-22)34-19-9-5-7-16-8-6-14-24-20(16)19/h5-15H,3-4H2,1-2H3,(H,25,26,27) |
| InChIKey | NLSFKHMJHNANJD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|