C20H12F3N5O2S — CID 22538596
5-nitro-6-quinolin-8-ylsulfanyl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 22538596) has the molecular formula C20H12F3N5O2S and a molecular weight of 443.41 g/mol. Its IUPAC name is 5-nitro-6-quinolin-8-ylsulfanyl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-nitro-6-quinolin-8-ylsulfanyl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22538596 |
| Molecular Formula | C20H12F3N5O2S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 5-nitro-6-quinolin-8-ylsulfanyl-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(C(F)(F)F)cc2)ncnc1Sc1cccc2cccnc12 |
| InChI | InChI=1S/C20H12F3N5O2S/c21-20(22,23)13-6-8-14(9-7-13)27-18-17(28(29)30)19(26-11-25-18)31-15-5-1-3-12-4-2-10-24-16(12)15/h1-11H,(H,25,26,27) |
| InChIKey | GATRELSKYZEYJQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|