C21H17N5O3S — CID 23494750
N-[(4-methoxyphenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine (PubChem CID 23494750) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23494750 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc(Sc3cccc4cccnc34)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N5O3S/c1-29-16-9-7-14(8-10-16)12-23-20-19(26(27)28)21(25-13-24-20)30-17-6-2-4-15-5-3-11-22-18(15)17/h2-11,13H,12H2,1H3,(H,23,24,25) |
| InChIKey | AHWLBFXQJBIHMV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|