C18H14N6O2S2 — CID 22534012
4,5-dimethyl-N-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 22534012) has the molecular formula C18H14N6O2S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4,5-dimethyl-N-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4,5-dimethyl-N-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 22534012 |
| Molecular Formula | C18H14N6O2S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4,5-dimethyl-N-(5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(Nc2ncnc(Sc3cccc4cccnc34)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C18H14N6O2S2/c1-10-11(2)27-18(22-10)23-16-15(24(25)26)17(21-9-20-16)28-13-7-3-5-12-6-4-8-19-14(12)13/h3-9H,1-2H3,(H,20,21,22,23) |
| InChIKey | CYDZUVYBXJQMFP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|