C20H14ClN5O2S — CID 22538972
N-[(2-chlorophenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine (PubChem CID 22538972) has the molecular formula C20H14ClN5O2S and a molecular weight of 423.89 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 22538972 |
| Molecular Formula | C20H14ClN5O2S |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-nitro-6-quinolin-8-ylsulfanylpyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2Cl)ncnc1Sc1cccc2cccnc12 |
| InChI | InChI=1S/C20H14ClN5O2S/c21-15-8-2-1-5-14(15)11-23-19-18(26(27)28)20(25-12-24-19)29-16-9-3-6-13-7-4-10-22-17(13)16/h1-10,12H,11H2,(H,23,24,25) |
| InChIKey | VFQFBXXEPFVWBO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|