C21H17N7O3 — CID 22527264
4-methyl-N'-[5-nitro-6-(quinolin-8-ylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 22527264) has the molecular formula C21H17N7O3 and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-methyl-N'-[5-nitro-6-(quinolin-8-ylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-methyl-N'-[5-nitro-6-(quinolin-8-ylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22527264 |
| Molecular Formula | C21H17N7O3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 4-methyl-N'-[5-nitro-6-(quinolin-8-ylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2ncnc(Nc3cccc4cccnc34)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N7O3/c1-13-7-9-15(10-8-13)21(29)27-26-20-18(28(30)31)19(23-12-24-20)25-16-6-2-4-14-5-3-11-22-17(14)16/h2-12H,1H3,(H,27,29)(H2,23,24,25,26) |
| InChIKey | WEZXWANSPKLOFC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|