C10H11N7O — CID 19137173
N'-(5,6-diaminopyrimidin-4-yl)pyridine-4-carbohydrazide (PubChem CID 19137173) has the molecular formula C10H11N7O and a molecular weight of 245.25 g/mol. Its IUPAC name is N'-(5,6-diaminopyrimidin-4-yl)pyridine-4-carbohydrazide.
| Compound Name | N'-(5,6-diaminopyrimidin-4-yl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 19137173 |
| Molecular Formula | C10H11N7O |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N'-(5,6-diaminopyrimidin-4-yl)pyridine-4-carbohydrazide |
| SMILES | Nc1ncnc(NNC(=O)c2ccncc2)c1N |
| InChI | InChI=1S/C10H11N7O/c11-7-8(12)14-5-15-9(7)16-17-10(18)6-1-3-13-4-2-6/h1-5H,11H2,(H,17,18)(H3,12,14,15,16) |
| InChIKey | GUFRQIQIYVWRRV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|