C16H21ClN6O — CID 19139837
N'-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19139837) has the molecular formula C16H21ClN6O and a molecular weight of 348.84 g/mol. Its IUPAC name is N'-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19139837 |
| Molecular Formula | C16H21ClN6O |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N'-[5-amino-6-[butyl(methyl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | CCCCN(C)c1ncnc(NNC(=O)c2cccc(Cl)c2)c1N |
| InChI | InChI=1S/C16H21ClN6O/c1-3-4-8-23(2)15-13(18)14(19-10-20-15)21-22-16(24)11-6-5-7-12(17)9-11/h5-7,9-10H,3-4,8,18H2,1-2H3,(H,22,24)(H,19,20,21) |
| InChIKey | LVOGALCXGLKLMK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|