C19H18Cl2N6O3 — CID 19151549
N'-[5-amino-6-(5-chloro-2,4-dimethoxyanilino)pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19151549) has the molecular formula C19H18Cl2N6O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is N'-[5-amino-6-(5-chloro-2,4-dimethoxyanilino)pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(5-chloro-2,4-dimethoxyanilino)pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19151549 |
| Molecular Formula | C19H18Cl2N6O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N'-[5-amino-6-(5-chloro-2,4-dimethoxyanilino)pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | COc1cc(OC)c(Nc2ncnc(NNC(=O)c3cccc(Cl)c3)c2N)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N6O3/c1-29-14-8-15(30-2)13(7-12(14)21)25-17-16(22)18(24-9-23-17)26-27-19(28)10-4-3-5-11(20)6-10/h3-9H,22H2,1-2H3,(H,27,28)(H2,23,24,25,26) |
| InChIKey | YREJFXOUUXGWQI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|