C20H16ClN7O — CID 19144781
N'-[5-amino-6-(quinolin-8-ylamino)pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19144781) has the molecular formula C20H16ClN7O and a molecular weight of 405.85 g/mol. Its IUPAC name is N'-[5-amino-6-(quinolin-8-ylamino)pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(quinolin-8-ylamino)pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19144781 |
| Molecular Formula | C20H16ClN7O |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N'-[5-amino-6-(quinolin-8-ylamino)pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2cccc(Cl)c2)ncnc1Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H16ClN7O/c21-14-7-1-5-13(10-14)20(29)28-27-19-16(22)18(24-11-25-19)26-15-8-2-4-12-6-3-9-23-17(12)15/h1-11H,22H2,(H,28,29)(H2,24,25,26,27) |
| InChIKey | SDRJBOJWDSPKQB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|