C23H27N7O — CID 19138271
N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19138271) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19138271 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | CN1CCN(c2ncnc(NNC(=O)C(c3ccccc3)c3ccccc3)c2N)CC1 |
| InChI | InChI=1S/C23H27N7O/c1-29-12-14-30(15-13-29)22-20(24)21(25-16-26-22)27-28-23(31)19(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,16,19H,12-15,24H2,1H3,(H,28,31)(H,25,26,27) |
| InChIKey | IGDRWRQBERLMQB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|