C20H23N7O — CID 19145603
N'-[5-amino-6-(2,2-dimethylhydrazinyl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19145603) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is N'-[5-amino-6-(2,2-dimethylhydrazinyl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(2,2-dimethylhydrazinyl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19145603 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N'-[5-amino-6-(2,2-dimethylhydrazinyl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | CN(C)Nc1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C20H23N7O/c1-27(2)26-19-17(21)18(22-13-23-19)24-25-20(28)16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16H,21H2,1-2H3,(H,25,28)(H2,22,23,24,26) |
| InChIKey | BFCBTLKJGIVJMM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|