C12H17N7 — CID 133365798
4-(4-methylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine (PubChem CID 133365798) has the molecular formula C12H17N7 and a molecular weight of 259.32 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 133365798 |
| Molecular Formula | C12H17N7 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine |
| SMILES | CN1CCN(c2ncnc(-n3cccn3)c2N)CC1 |
| InChI | InChI=1S/C12H17N7/c1-17-5-7-18(8-6-17)11-10(13)12(15-9-14-11)19-4-2-3-16-19/h2-4,9H,5-8,13H2,1H3 |
| InChIKey | BUSNQOXMOULDMJ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |