C24H25N7 — CID 133365860
4-(4-benzhydrylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine (PubChem CID 133365860) has the molecular formula C24H25N7 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-(4-benzhydrylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine.
| Compound Name | 4-(4-benzhydrylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 133365860 |
| Molecular Formula | C24H25N7 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-(4-benzhydrylpiperazin-1-yl)-6-pyrazol-1-ylpyrimidin-5-amine |
| SMILES | Nc1c(N2CCN(C(c3ccccc3)c3ccccc3)CC2)ncnc1-n1cccn1 |
| InChI | InChI=1S/C24H25N7/c25-21-23(26-18-27-24(21)31-13-7-12-28-31)30-16-14-29(15-17-30)22(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-13,18,22H,14-17,25H2 |
| InChIKey | MOAPOMHCDLUKMP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |