C24H30N6O — CID 19139653
6-(4-benzhydrylpiperazin-1-yl)-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine (PubChem CID 19139653) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 6-(4-benzhydrylpiperazin-1-yl)-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(4-benzhydrylpiperazin-1-yl)-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19139653 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 6-(4-benzhydrylpiperazin-1-yl)-4-N-(2-methoxyethyl)pyrimidine-4,5-diamine |
| SMILES | COCCNc1ncnc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1N |
| InChI | InChI=1S/C24H30N6O/c1-31-17-12-26-23-21(25)24(28-18-27-23)30-15-13-29(14-16-30)22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,18,22H,12-17,25H2,1H3,(H,26,27,28) |
| InChIKey | KDYGTRXWZAFAQB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|