C25H32N6 — CID 19134793
6-(4-benzhydrylpiperazin-1-yl)-4-N-butylpyrimidine-4,5-diamine (PubChem CID 19134793) has the molecular formula C25H32N6 and a molecular weight of 416.57 g/mol. Its IUPAC name is 6-(4-benzhydrylpiperazin-1-yl)-4-N-butylpyrimidine-4,5-diamine.
| Compound Name | 6-(4-benzhydrylpiperazin-1-yl)-4-N-butylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19134793 |
| Molecular Formula | C25H32N6 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 6-(4-benzhydrylpiperazin-1-yl)-4-N-butylpyrimidine-4,5-diamine |
| SMILES | CCCCNc1ncnc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1N |
| InChI | InChI=1S/C25H32N6/c1-2-3-14-27-24-22(26)25(29-19-28-24)31-17-15-30(16-18-31)23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,19,23H,2-3,14-18,26H2,1H3,(H,27,28,29) |
| InChIKey | SYDNLWUMQRNHKL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|