C12H18ClN5 — CID 82460054
6-chloro-N-hexyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 82460054) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-chloro-N-hexyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-hexyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82460054 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 6-chloro-N-hexyl-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCCCNc1nc(Cl)nc2c1cnn2C |
| InChI | InChI=1S/C12H18ClN5/c1-3-4-5-6-7-14-10-9-8-15-18(2)11(9)17-12(13)16-10/h8H,3-7H2,1-2H3,(H,14,16,17) |
| InChIKey | CAMLPQXJDUPMST-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|