C15H25N5S — CID 107756434
1-methyl-6-(pentylsulfanylmethyl)-N-propylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 107756434) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 1-methyl-6-(pentylsulfanylmethyl)-N-propylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-6-(pentylsulfanylmethyl)-N-propylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107756434 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-methyl-6-(pentylsulfanylmethyl)-N-propylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCCSCc1nc(NCCC)c2cnn(C)c2n1 |
| InChI | InChI=1S/C15H25N5S/c1-4-6-7-9-21-11-13-18-14(16-8-5-2)12-10-17-20(3)15(12)19-13/h10H,4-9,11H2,1-3H3,(H,16,18,19) |
| InChIKey | WBQYAGLKYVMUHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|