C17H20FN5S — CID 72889142
N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 72889142) has the molecular formula C17H20FN5S and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72889142 |
| Molecular Formula | C17H20FN5S |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[3-[(2-fluorophenyl)methylsulfanyl]propyl]-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NCCCSCc2ccccc2F)c2cnn(C)c2n1 |
| InChI | InChI=1S/C17H20FN5S/c1-12-21-16(14-10-20-23(2)17(14)22-12)19-8-5-9-24-11-13-6-3-4-7-15(13)18/h3-4,6-7,10H,5,8-9,11H2,1-2H3,(H,19,21,22) |
| InChIKey | NYHDKBWYZSBBQE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|