C12H14ClN5S — CID 114268167
2-chloro-N-(3-imidazol-1-ylpropyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine (PubChem CID 114268167) has the molecular formula C12H14ClN5S and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-chloro-N-(3-imidazol-1-ylpropyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3-imidazol-1-ylpropyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114268167 |
| Molecular Formula | C12H14ClN5S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-chloro-N-(3-imidazol-1-ylpropyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1nc2c(c(NCCCn3ccnc3)n1)SCC2 |
| InChI | InChI=1S/C12H14ClN5S/c13-12-16-9-2-7-19-10(9)11(17-12)15-3-1-5-18-6-4-14-8-18/h4,6,8H,1-3,5,7H2,(H,15,16,17) |
| InChIKey | AMEBPPVEEVDCON-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|