C12H18N4 — CID 62925537
4-[4-(dimethylamino)butylamino]pyridine-2-carbonitrile (PubChem CID 62925537) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-[4-(dimethylamino)butylamino]pyridine-2-carbonitrile.
| Compound Name | 4-[4-(dimethylamino)butylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62925537 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-[4-(dimethylamino)butylamino]pyridine-2-carbonitrile |
| SMILES | CN(C)CCCCNc1ccnc(C#N)c1 |
| InChI | InChI=1S/C12H18N4/c1-16(2)8-4-3-6-14-11-5-7-15-12(9-11)10-13/h5,7,9H,3-4,6,8H2,1-2H3,(H,14,15) |
| InChIKey | ICAVTRDEIUCBPK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|