C11H10F4N2 — CID 114169420
4-methyl-2-(2,2,3,3-tetrafluoropropylamino)benzonitrile (PubChem CID 114169420) has the molecular formula C11H10F4N2 and a molecular weight of 246.21 g/mol. Its IUPAC name is 4-methyl-2-(2,2,3,3-tetrafluoropropylamino)benzonitrile.
| Compound Name | 4-methyl-2-(2,2,3,3-tetrafluoropropylamino)benzonitrile |
|---|---|
| PubChem CID | 114169420 |
| Molecular Formula | C11H10F4N2 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-methyl-2-(2,2,3,3-tetrafluoropropylamino)benzonitrile |
| SMILES | Cc1ccc(C#N)c(NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H10F4N2/c1-7-2-3-8(5-16)9(4-7)17-6-11(14,15)10(12)13/h2-4,10,17H,6H2,1H3 |
| InChIKey | FOUOQKIHHWVORK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|