C8H10F3N3O2S — CID 79467392
2-amino-4-(2,2,2-trifluoroethylamino)benzenesulfonamide (PubChem CID 79467392) has the molecular formula C8H10F3N3O2S and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-amino-4-(2,2,2-trifluoroethylamino)benzenesulfonamide.
| Compound Name | 2-amino-4-(2,2,2-trifluoroethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 79467392 |
| Molecular Formula | C8H10F3N3O2S |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-amino-4-(2,2,2-trifluoroethylamino)benzenesulfonamide |
| SMILES | Nc1cc(NCC(F)(F)F)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C8H10F3N3O2S/c9-8(10,11)4-14-5-1-2-7(6(12)3-5)17(13,15)16/h1-3,14H,4,12H2,(H2,13,15,16) |
| InChIKey | BREOEQBSPCSLKN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|